C18H20N4O4 — CID 23455172
[1-methyl-3-(2-methylpropyl)-2,6-dioxopurin-7-yl]methyl benzoate (PubChem CID 23455172) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is [1-methyl-3-(2-methylpropyl)-2,6-dioxopurin-7-yl]methyl benzoate.
| Compound Name | [1-methyl-3-(2-methylpropyl)-2,6-dioxopurin-7-yl]methyl benzoate |
|---|---|
| PubChem CID | 23455172 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [1-methyl-3-(2-methylpropyl)-2,6-dioxopurin-7-yl]methyl benzoate |
| SMILES | CC(C)Cn1c(=O)n(C)c(=O)c2c1ncn2COC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20N4O4/c1-12(2)9-22-15-14(16(23)20(3)18(22)25)21(10-19-15)11-26-17(24)13-7-5-4-6-8-13/h4-8,10,12H,9,11H2,1-3H3 |
| InChIKey | RBMNLUMRBNVKDF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |