C11H14N4O5 — CID 23455264
(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl ethyl carbonate (PubChem CID 23455264) has the molecular formula C11H14N4O5 and a molecular weight of 282.26 g/mol. Its IUPAC name is (1,3-dimethyl-2,6-dioxopurin-7-yl)methyl ethyl carbonate.
| Compound Name | (1,3-dimethyl-2,6-dioxopurin-7-yl)methyl ethyl carbonate |
|---|---|
| PubChem CID | 23455264 |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (1,3-dimethyl-2,6-dioxopurin-7-yl)methyl ethyl carbonate |
| SMILES | CCOC(=O)OCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C11H14N4O5/c1-4-19-11(18)20-6-15-5-12-8-7(15)9(16)14(3)10(17)13(8)2/h5H,4,6H2,1-3H3 |
| InChIKey | CRROIRSDBVLXGH-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 97.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |