C12H14N4O5 — CID 4692441
2-oxopropyl 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (PubChem CID 4692441) has the molecular formula C12H14N4O5 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-oxopropyl 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.
| Compound Name | 2-oxopropyl 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
|---|---|
| PubChem CID | 4692441 |
| Molecular Formula | C12H14N4O5 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-oxopropyl 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| SMILES | CC(=O)COC(=O)Cn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C12H14N4O5/c1-7(17)5-21-8(18)4-16-6-13-10-9(16)11(19)15(3)12(20)14(10)2/h6H,4-5H2,1-3H3 |
| InChIKey | DMZNANPJCNZPER-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 105.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |