C14H17N5O5 — CID 3340826
[2-oxo-2-(prop-2-enylamino)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (PubChem CID 3340826) has the molecular formula C14H17N5O5 and a molecular weight of 335.32 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
|---|---|
| PubChem CID | 3340826 |
| Molecular Formula | C14H17N5O5 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| SMILES | C=CCNC(=O)COC(=O)Cn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H17N5O5/c1-4-5-15-9(20)7-24-10(21)6-19-8-16-12-11(19)13(22)18(3)14(23)17(12)2/h4,8H,1,5-7H2,2-3H3,(H,15,20) |
| InChIKey | KWTFFHVHWYHJQR-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|