C20H23N5O5 — CID 4684428
[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (PubChem CID 4684428) has the molecular formula C20H23N5O5 and a molecular weight of 413.43 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.
| Compound Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
|---|---|
| PubChem CID | 4684428 |
| Molecular Formula | C20H23N5O5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| SMILES | C=CCn1c(C)cc(C(=O)COC(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)c1C |
| InChI | InChI=1S/C20H23N5O5/c1-6-7-25-12(2)8-14(13(25)3)15(26)10-30-16(27)9-24-11-21-18-17(24)19(28)23(5)20(29)22(18)4/h6,8,11H,1,7,9-10H2,2-5H3 |
| InChIKey | IWWUYDZWWFYCHA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 110.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|