C21H22N6O3S — CID 43980450
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 43980450) has the molecular formula C21H22N6O3S and a molecular weight of 438.51 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 43980450 |
| Molecular Formula | C21H22N6O3S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5,6-dimethyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C21H22N6O3S/c1-6-7-27-14-8-12(2)13(3)9-15(14)31-20(27)23-16(28)10-26-11-22-18-17(26)19(29)25(5)21(30)24(18)4/h6,8-9,11H,1,7,10H2,2-5H3/b23-20- |
| InChIKey | NYWSRJHEJWNRMM-ATJXCDBQSA-N |
| XLogP | 1.38 |
| TPSA | 96.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|