C21H20N6O3S — CID 43945925
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 43945925) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 43945925 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(6-ethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C#CCn1/c(=N/C(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)sc2cc(CC)ccc21 |
| InChI | InChI=1S/C21H20N6O3S/c1-5-9-27-14-8-7-13(6-2)10-15(14)31-20(27)23-16(28)11-26-12-22-18-17(26)19(29)25(4)21(30)24(18)3/h1,7-8,10,12H,6,9,11H2,2-4H3/b23-20- |
| InChIKey | JRIPWEHMDKEAJR-ATJXCDBQSA-N |
| XLogP | 0.77 |
| TPSA | 96.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|