C19H25N5O5 — CID 4578653
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (PubChem CID 4578653) has the molecular formula C19H25N5O5 and a molecular weight of 403.44 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
|---|---|
| PubChem CID | 4578653 |
| Molecular Formula | C19H25N5O5 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)OCC(=O)NCCC2=CCCCC2)n(C)c1=O |
| InChI | InChI=1S/C19H25N5O5/c1-22-17-16(18(27)23(2)19(22)28)24(12-21-17)10-15(26)29-11-14(25)20-9-8-13-6-4-3-5-7-13/h6,12H,3-5,7-11H2,1-2H3,(H,20,25) |
| InChIKey | BJTLCTJRRLKYLJ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|