C16H23N5O5 — CID 3771583
methyl 6-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]hexanoate (PubChem CID 3771583) has the molecular formula C16H23N5O5 and a molecular weight of 365.39 g/mol. Its IUPAC name is methyl 6-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]hexanoate.
| Compound Name | methyl 6-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 3771583 |
| Molecular Formula | C16H23N5O5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | methyl 6-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)Cn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H23N5O5/c1-19-14-13(15(24)20(2)16(19)25)21(10-18-14)9-11(22)17-8-6-4-5-7-12(23)26-3/h10H,4-9H2,1-3H3,(H,17,22) |
| InChIKey | REYQJCZSBSVLDV-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|