C16H27ClN6O3 — CID 24844053
N-[3-(diethylamino)propyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide;hydrochloride (PubChem CID 24844053) has the molecular formula C16H27ClN6O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide;hydrochloride.
| Compound Name | N-[3-(diethylamino)propyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 24844053 |
| Molecular Formula | C16H27ClN6O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide;hydrochloride |
| SMILES | CCN(CC)CCCNC(=O)Cn1cnc2c1c(=O)n(C)c(=O)n2C.Cl |
| InChI | InChI=1S/C16H26N6O3.ClH/c1-5-21(6-2)9-7-8-17-12(23)10-22-11-18-14-13(22)15(24)20(4)16(25)19(14)3;/h11H,5-10H2,1-4H3,(H,17,23);1H |
| InChIKey | FRGFQZZFSYCZLL-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 94.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|