C22H29N7O3 — CID 38448878
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]acetamide (PubChem CID 38448878) has the molecular formula C22H29N7O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 38448878 |
| Molecular Formula | C22H29N7O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]acetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)NCCCN2CCN(c3ccccc3)CC2)n(C)c1=O |
| InChI | InChI=1S/C22H29N7O3/c1-25-20-19(21(31)26(2)22(25)32)29(16-24-20)15-18(30)23-9-6-10-27-11-13-28(14-12-27)17-7-4-3-5-8-17/h3-5,7-8,16H,6,9-15H2,1-2H3,(H,23,30) |
| InChIKey | BYDVKZJFWGAFKR-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|