C18H29N5O4 — CID 37346021
N-(3-butoxypropyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide (PubChem CID 37346021) has the molecular formula C18H29N5O4 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-(3-butoxypropyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide.
| Compound Name | N-(3-butoxypropyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide |
|---|---|
| PubChem CID | 37346021 |
| Molecular Formula | C18H29N5O4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | N-(3-butoxypropyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide |
| SMILES | CCCCOCCCNC(=O)CCCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C18H29N5O4/c1-4-5-11-27-12-7-9-19-14(24)8-6-10-23-13-20-16-15(23)17(25)22(3)18(26)21(16)2/h13H,4-12H2,1-3H3,(H,19,24) |
| InChIKey | CMNCOILZNNBSOH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|