C19H23N5O4 — CID 40511732
4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-ethoxyphenyl)butanamide (PubChem CID 40511732) has the molecular formula C19H23N5O4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-ethoxyphenyl)butanamide.
| Compound Name | 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-ethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 40511732 |
| Molecular Formula | C19H23N5O4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-ethoxyphenyl)butanamide |
| SMILES | CCOc1ccccc1NC(=O)CCCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C19H23N5O4/c1-4-28-14-9-6-5-8-13(14)21-15(25)10-7-11-24-12-20-17-16(24)18(26)23(3)19(27)22(17)2/h5-6,8-9,12H,4,7,10-11H2,1-3H3,(H,21,25) |
| InChIKey | DWSVPEWRLIFCGH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |