C18H20N6O5 — CID 26737759
4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methyl-3-nitrophenyl)butanamide (PubChem CID 26737759) has the molecular formula C18H20N6O5 and a molecular weight of 400.40 g/mol. Its IUPAC name is 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methyl-3-nitrophenyl)butanamide.
| Compound Name | 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methyl-3-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 26737759 |
| Molecular Formula | C18H20N6O5 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methyl-3-nitrophenyl)butanamide |
| SMILES | Cc1c(NC(=O)CCCn2cnc3c2c(=O)n(C)c(=O)n3C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N6O5/c1-11-12(6-4-7-13(11)24(28)29)20-14(25)8-5-9-23-10-19-16-15(23)17(26)22(3)18(27)21(16)2/h4,6-7,10H,5,8-9H2,1-3H3,(H,20,25) |
| InChIKey | ODKIKLVTFGZNFK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|