C20H25N5O3 — CID 18775193
4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2,4,6-trimethylphenyl)butanamide (PubChem CID 18775193) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 18775193 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2,4,6-trimethylphenyl)butanamide |
| SMILES | Cc1cc(C)c(NC(=O)CCCn2cnc3c2c(=O)n(C)c(=O)n3C)c(C)c1 |
| InChI | InChI=1S/C20H25N5O3/c1-12-9-13(2)16(14(3)10-12)22-15(26)7-6-8-25-11-21-18-17(25)19(27)24(5)20(28)23(18)4/h9-11H,6-8H2,1-5H3,(H,22,26) |
| InChIKey | VCTGRPIFCRSPFF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |