C18H20N6O4 — CID 9399029
2-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanoylamino]benzamide (PubChem CID 9399029) has the molecular formula C18H20N6O4 and a molecular weight of 384.40 g/mol. Its IUPAC name is 2-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanoylamino]benzamide.
| Compound Name | 2-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanoylamino]benzamide |
|---|---|
| PubChem CID | 9399029 |
| Molecular Formula | C18H20N6O4 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanoylamino]benzamide |
| SMILES | Cn1c(=O)c2c(ncn2CCCC(=O)Nc2ccccc2C(N)=O)n(C)c1=O |
| InChI | InChI=1S/C18H20N6O4/c1-22-16-14(17(27)23(2)18(22)28)24(10-20-16)9-5-8-13(25)21-12-7-4-3-6-11(12)15(19)26/h3-4,6-7,10H,5,8-9H2,1-2H3,(H2,19,26)(H,21,25) |
| InChIKey | OOTHSTKPNWMTRP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |