C17H19N5O4 — CID 6494608
3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxyphenyl)propanamide (PubChem CID 6494608) has the molecular formula C17H19N5O4 and a molecular weight of 357.37 g/mol. Its IUPAC name is 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxyphenyl)propanamide.
| Compound Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 6494608 |
| Molecular Formula | C17H19N5O4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(2-methoxyphenyl)propanamide |
| SMILES | COc1ccccc1NC(=O)CCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H19N5O4/c1-20-15-14(16(24)21(2)17(20)25)22(10-18-15)9-8-13(23)19-11-6-4-5-7-12(11)26-3/h4-7,10H,8-9H2,1-3H3,(H,19,23) |
| InChIKey | CMKXHEFBXRLSRL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |