C16H14N6O3 — CID 798673
N-(2-cyanophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide (PubChem CID 798673) has the molecular formula C16H14N6O3 and a molecular weight of 338.33 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide.
| Compound Name | N-(2-cyanophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
|---|---|
| PubChem CID | 798673 |
| Molecular Formula | C16H14N6O3 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | N-(2-cyanophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)Nc2ccccc2C#N)n(C)c1=O |
| InChI | InChI=1S/C16H14N6O3/c1-20-14-13(15(24)21(2)16(20)25)22(9-18-14)8-12(23)19-11-6-4-3-5-10(11)7-17/h3-6,9H,8H2,1-2H3,(H,19,23) |
| InChIKey | CQVFBCMLOUFEIH-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |