C15H14FN5O4 — CID 166187134
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-fluoro-2-hydroxyphenyl)acetamide (PubChem CID 166187134) has the molecular formula C15H14FN5O4 and a molecular weight of 347.31 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-fluoro-2-hydroxyphenyl)acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-fluoro-2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 166187134 |
| Molecular Formula | C15H14FN5O4 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(5-fluoro-2-hydroxyphenyl)acetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)Nc2cc(F)ccc2O)n(C)c1=O |
| InChI | InChI=1S/C15H14FN5O4/c1-19-13-12(14(24)20(2)15(19)25)21(7-17-13)6-11(23)18-9-5-8(16)3-4-10(9)22/h3-5,7,22H,6H2,1-2H3,(H,18,23) |
| InChIKey | GHTGVFZJVXDHBO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|