C15H14N5O3Y- — CID 88570004
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-phenylacetamide;yttrium (PubChem CID 88570004) has the molecular formula C15H14N5O3Y- and a molecular weight of 401.22 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-phenylacetamide;yttrium.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-phenylacetamide;yttrium |
|---|---|
| PubChem CID | 88570004 |
| Molecular Formula | C15H14N5O3Y- |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-phenylacetamide;yttrium |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)Nc2cc[c-]cc2)n(C)c1=O.[Y] |
| InChI | InChI=1S/C15H14N5O3.Y/c1-18-13-12(14(22)19(2)15(18)23)20(9-16-13)8-11(21)17-10-6-4-3-5-7-10;/h4-7,9H,8H2,1-2H3,(H,17,21);/q-1; |
| InChIKey | LPNPJVJOWBAZIE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|