C20H18N6O3 — CID 86764603
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-pyridin-3-ylphenyl)acetamide (PubChem CID 86764603) has the molecular formula C20H18N6O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-pyridin-3-ylphenyl)acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-pyridin-3-ylphenyl)acetamide |
|---|---|
| PubChem CID | 86764603 |
| Molecular Formula | C20H18N6O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-pyridin-3-ylphenyl)acetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)Nc2ccc(-c3cccnc3)cc2)n(C)c1=O |
| InChI | InChI=1S/C20H18N6O3/c1-24-18-17(19(28)25(2)20(24)29)26(12-22-18)11-16(27)23-15-7-5-13(6-8-15)14-4-3-9-21-10-14/h3-10,12H,11H2,1-2H3,(H,23,27) |
| InChIKey | CSCXMWIBZGSKEK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |