C16H17N6O4+ — CID 58312063
[3-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]phenyl]-methyl-oxoazanium (PubChem CID 58312063) has the molecular formula C16H17N6O4+ and a molecular weight of 357.35 g/mol. Its IUPAC name is [3-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]phenyl]-methyl-oxoazanium.
| Compound Name | [3-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]phenyl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 58312063 |
| Molecular Formula | C16H17N6O4+ |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | [3-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]phenyl]-methyl-oxoazanium |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)Nc2cccc([N+](C)=O)c2)n(C)c1=O |
| InChI | InChI=1S/C16H16N6O4/c1-19-14-13(15(24)20(2)16(19)25)22(9-17-14)8-12(23)18-10-5-4-6-11(7-10)21(3)26/h4-7,9H,8H2,1-3H3/p+1 |
| InChIKey | XWEYRJMNNSEAQK-UHFFFAOYSA-O |
| XLogP | 0.11 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|