C16H18N6O5S — CID 25390507
3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(3-sulfamoylphenyl)propanamide (PubChem CID 25390507) has the molecular formula C16H18N6O5S and a molecular weight of 406.42 g/mol. Its IUPAC name is 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(3-sulfamoylphenyl)propanamide.
| Compound Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(3-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 25390507 |
| Molecular Formula | C16H18N6O5S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(3-sulfamoylphenyl)propanamide |
| SMILES | Cn1c(=O)c2c(ncn2CCC(=O)Nc2cccc(S(N)(=O)=O)c2)n(C)c1=O |
| InChI | InChI=1S/C16H18N6O5S/c1-20-14-13(15(24)21(2)16(20)25)22(9-18-14)7-6-12(23)19-10-4-3-5-11(8-10)28(17,26)27/h3-5,8-9H,6-7H2,1-2H3,(H,19,23)(H2,17,26,27) |
| InChIKey | YBPJYLGTNNMWNG-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |