C14H8N6O — CID 115944720
N-(2-cyanophenyl)-2-(4,5-dicyanoimidazol-1-yl)acetamide (PubChem CID 115944720) has the molecular formula C14H8N6O and a molecular weight of 276.26 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-(4,5-dicyanoimidazol-1-yl)acetamide.
| Compound Name | N-(2-cyanophenyl)-2-(4,5-dicyanoimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 115944720 |
| Molecular Formula | C14H8N6O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | N-(2-cyanophenyl)-2-(4,5-dicyanoimidazol-1-yl)acetamide |
| SMILES | N#Cc1ccccc1NC(=O)Cn1cnc(C#N)c1C#N |
| InChI | InChI=1S/C14H8N6O/c15-5-10-3-1-2-4-11(10)19-14(21)8-20-9-18-12(6-16)13(20)7-17/h1-4,9H,8H2,(H,19,21) |
| InChIKey | HGBKNCLIAPGDNS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |