C13H10N4O2S — CID 2978535
N-(2-cyanophenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 2978535) has the molecular formula C13H10N4O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2-cyanophenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2978535 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | N-(2-cyanophenyl)-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | N#Cc1ccccc1NC(=O)CSc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C13H10N4O2S/c14-7-9-3-1-2-4-10(9)16-12(19)8-20-13-15-6-5-11(18)17-13/h1-6H,8H2,(H,16,19)(H,15,17,18) |
| InChIKey | DEXOJEXUXCUCKK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |