C14H15N3O2S — CID 7213972
2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[(1S)-1-phenylethyl]acetamide (PubChem CID 7213972) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[(1S)-1-phenylethyl]acetamide.
| Compound Name | 2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[(1S)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 7213972 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[(1S)-1-phenylethyl]acetamide |
| SMILES | C[C@H](NC(=O)CSc1nccc(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C14H15N3O2S/c1-10(11-5-3-2-4-6-11)16-13(19)9-20-14-15-8-7-12(18)17-14/h2-8,10H,9H2,1H3,(H,16,19)(H,15,17,18)/t10-/m0/s1 |
| InChIKey | YFIPYQIJFDTDNE-JTQLQIEISA-N |
| XLogP | 1.74 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |