C18H15N5O2S — CID 9144228
2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(4-phenyldiazenylphenyl)acetamide (PubChem CID 9144228) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is 2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(4-phenyldiazenylphenyl)acetamide.
| Compound Name | 2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(4-phenyldiazenylphenyl)acetamide |
|---|---|
| PubChem CID | 9144228 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(4-phenyldiazenylphenyl)acetamide |
| SMILES | O=C(CSc1nccc(=O)[nH]1)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N5O2S/c24-16-10-11-19-18(21-16)26-12-17(25)20-13-6-8-15(9-7-13)23-22-14-4-2-1-3-5-14/h1-11H,12H2,(H,20,25)(H,19,21,24)/b23-22+ |
| InChIKey | WKRRTQOKKSQJHP-GHVJWSGMSA-N |
| XLogP | 3.92 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|