C14H12N4O2S2 — CID 9144056
N-[2-(cyanomethylsulfanyl)phenyl]-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 9144056) has the molecular formula C14H12N4O2S2 and a molecular weight of 332.41 g/mol. Its IUPAC name is N-[2-(cyanomethylsulfanyl)phenyl]-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 9144056 |
| Molecular Formula | C14H12N4O2S2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | N-[2-(cyanomethylsulfanyl)phenyl]-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | N#CCSc1ccccc1NC(=O)CSc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C14H12N4O2S2/c15-6-8-21-11-4-2-1-3-10(11)17-13(20)9-22-14-16-7-5-12(19)18-14/h1-5,7H,8-9H2,(H,17,20)(H,16,18,19) |
| InChIKey | UPWSTOFFEJHVSQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |