C12H9N3O2S — CID 63312447
N-(2-cyanophenyl)-2-(2-oxo-1,3-thiazol-3-yl)acetamide (PubChem CID 63312447) has the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-(2-oxo-1,3-thiazol-3-yl)acetamide.
| Compound Name | N-(2-cyanophenyl)-2-(2-oxo-1,3-thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 63312447 |
| Molecular Formula | C12H9N3O2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | N-(2-cyanophenyl)-2-(2-oxo-1,3-thiazol-3-yl)acetamide |
| SMILES | N#Cc1ccccc1NC(=O)Cn1ccsc1=O |
| InChI | InChI=1S/C12H9N3O2S/c13-7-9-3-1-2-4-10(9)14-11(16)8-15-5-6-18-12(15)17/h1-6H,8H2,(H,14,16) |
| InChIKey | HLJLOLAOKSVWDL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |