C17H18ClN5O3 — CID 40723559
N-(2-chlorophenyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide (PubChem CID 40723559) has the molecular formula C17H18ClN5O3 and a molecular weight of 375.82 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide.
| Compound Name | N-(2-chlorophenyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide |
|---|---|
| PubChem CID | 40723559 |
| Molecular Formula | C17H18ClN5O3 |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-(2-chlorophenyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide |
| SMILES | Cn1c(=O)c2c(ncn2CCCC(=O)Nc2ccccc2Cl)n(C)c1=O |
| InChI | InChI=1S/C17H18ClN5O3/c1-21-15-14(16(25)22(2)17(21)26)23(10-19-15)9-5-8-13(24)20-12-7-4-3-6-11(12)18/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,20,24) |
| InChIKey | KXPKMQJFNMTCJQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |