C17H17Br2N5O3 — CID 55611516
N-(2,5-dibromophenyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide (PubChem CID 55611516) has the molecular formula C17H17Br2N5O3 and a molecular weight of 499.16 g/mol. Its IUPAC name is N-(2,5-dibromophenyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide.
| Compound Name | N-(2,5-dibromophenyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide |
|---|---|
| PubChem CID | 55611516 |
| Molecular Formula | C17H17Br2N5O3 |
| Molecular Weight | 499.16 g/mol |
| Exact Mass | 496.97 |
| IUPAC Name | N-(2,5-dibromophenyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide |
| SMILES | Cn1c(=O)c2c(ncn2CCCC(=O)Nc2cc(Br)ccc2Br)n(C)c1=O |
| InChI | InChI=1S/C17H17Br2N5O3/c1-22-15-14(16(26)23(2)17(22)27)24(9-20-15)7-3-4-13(25)21-12-8-10(18)5-6-11(12)19/h5-6,8-9H,3-4,7H2,1-2H3,(H,21,25) |
| InChIKey | YJCDUAMSQFNMEZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.16 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |