C17H17ClFN5O3 — CID 40723752
N-(4-chloro-2-fluorophenyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide (PubChem CID 40723752) has the molecular formula C17H17ClFN5O3 and a molecular weight of 393.81 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide |
|---|---|
| PubChem CID | 40723752 |
| Molecular Formula | C17H17ClFN5O3 |
| Molecular Weight | 393.81 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide |
| SMILES | Cn1c(=O)c2c(ncn2CCCC(=O)Nc2ccc(Cl)cc2F)n(C)c1=O |
| InChI | InChI=1S/C17H17ClFN5O3/c1-22-15-14(16(26)23(2)17(22)27)24(9-20-15)7-3-4-13(25)21-12-6-5-10(18)8-11(12)19/h5-6,8-9H,3-4,7H2,1-2H3,(H,21,25) |
| InChIKey | IIBKMUOYPHMUIB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.81 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |