C15H15Br2N5O2 — CID 24583462
7-[2-(2,4-dibromoanilino)ethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 24583462) has the molecular formula C15H15Br2N5O2 and a molecular weight of 457.13 g/mol. Its IUPAC name is 7-[2-(2,4-dibromoanilino)ethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2-(2,4-dibromoanilino)ethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 24583462 |
| Molecular Formula | C15H15Br2N5O2 |
| Molecular Weight | 457.13 g/mol |
| Exact Mass | 454.96 |
| IUPAC Name | 7-[2-(2,4-dibromoanilino)ethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCNc2ccc(Br)cc2Br)n(C)c1=O |
| InChI | InChI=1S/C15H15Br2N5O2/c1-20-13-12(14(23)21(2)15(20)24)22(8-19-13)6-5-18-11-4-3-9(16)7-10(11)17/h3-4,7-8,18H,5-6H2,1-2H3 |
| InChIKey | RCURJHIEHNEPQY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.13 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |