C17H18N6O4 — CID 1203028
N-(3-acetamidophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide (PubChem CID 1203028) has the molecular formula C17H18N6O4 and a molecular weight of 370.37 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide.
| Compound Name | N-(3-acetamidophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
|---|---|
| PubChem CID | 1203028 |
| Molecular Formula | C17H18N6O4 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-(3-acetamidophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C17H18N6O4/c1-10(24)19-11-5-4-6-12(7-11)20-13(25)8-23-9-18-15-14(23)16(26)22(3)17(27)21(15)2/h4-7,9H,8H2,1-3H3,(H,19,24)(H,20,25) |
| InChIKey | GSGUURRRUWNOER-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |