C18H22N6O2 — CID 978607
7-benzyl-1,3-dimethyl-8-piperazin-1-ylpurine-2,6-dione (PubChem CID 978607) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 7-benzyl-1,3-dimethyl-8-piperazin-1-ylpurine-2,6-dione.
| Compound Name | 7-benzyl-1,3-dimethyl-8-piperazin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 978607 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 7-benzyl-1,3-dimethyl-8-piperazin-1-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CCNCC3)n2Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C18H22N6O2/c1-21-15-14(16(25)22(2)18(21)26)24(12-13-6-4-3-5-7-13)17(20-15)23-10-8-19-9-11-23/h3-7,19H,8-12H2,1-2H3 |
| InChIKey | QFSMMXJBEBXTJP-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |