C16H18BrN5O2 — CID 663626
7-[(3-bromophenyl)methyl]-3-methyl-8-(propylamino)purine-2,6-dione (PubChem CID 663626) has the molecular formula C16H18BrN5O2 and a molecular weight of 392.26 g/mol. Its IUPAC name is 7-[(3-bromophenyl)methyl]-3-methyl-8-(propylamino)purine-2,6-dione.
| Compound Name | 7-[(3-bromophenyl)methyl]-3-methyl-8-(propylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 663626 |
| Molecular Formula | C16H18BrN5O2 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 7-[(3-bromophenyl)methyl]-3-methyl-8-(propylamino)purine-2,6-dione |
| SMILES | CCCNc1nc2c(c(=O)[nH]c(=O)n2C)n1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C16H18BrN5O2/c1-3-7-18-15-19-13-12(14(23)20-16(24)21(13)2)22(15)9-10-5-4-6-11(17)8-10/h4-6,8H,3,7,9H2,1-2H3,(H,18,19)(H,20,23,24) |
| InChIKey | CKOMTIXKMWULCV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |