C21H21N5O3S — CID 86765042
4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-thiophen-3-ylphenyl)butanamide (PubChem CID 86765042) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-thiophen-3-ylphenyl)butanamide.
| Compound Name | 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-thiophen-3-ylphenyl)butanamide |
|---|---|
| PubChem CID | 86765042 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(4-thiophen-3-ylphenyl)butanamide |
| SMILES | Cn1c(=O)c2c(ncn2CCCC(=O)Nc2ccc(-c3ccsc3)cc2)n(C)c1=O |
| InChI | InChI=1S/C21H21N5O3S/c1-24-19-18(20(28)25(2)21(24)29)26(13-22-19)10-3-4-17(27)23-16-7-5-14(6-8-16)15-9-11-30-12-15/h5-9,11-13H,3-4,10H2,1-2H3,(H,23,27) |
| InChIKey | OCMLPFZZHBKPHP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |