C16H19N5O3S — CID 55688518
4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(thiophen-3-ylmethyl)butanamide (PubChem CID 55688518) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol. Its IUPAC name is 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(thiophen-3-ylmethyl)butanamide.
| Compound Name | 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(thiophen-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 55688518 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(thiophen-3-ylmethyl)butanamide |
| SMILES | Cn1c(=O)c2c(ncn2CCCC(=O)NCc2ccsc2)n(C)c1=O |
| InChI | InChI=1S/C16H19N5O3S/c1-19-14-13(15(23)20(2)16(19)24)21(10-18-14)6-3-4-12(22)17-8-11-5-7-25-9-11/h5,7,9-10H,3-4,6,8H2,1-2H3,(H,17,22) |
| InChIKey | MJZPRVSHYHVLFA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |