C20H26N6O5S — CID 55726478
N-[2-(benzylsulfamoyl)ethyl]-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide (PubChem CID 55726478) has the molecular formula C20H26N6O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[2-(benzylsulfamoyl)ethyl]-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide.
| Compound Name | N-[2-(benzylsulfamoyl)ethyl]-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide |
|---|---|
| PubChem CID | 55726478 |
| Molecular Formula | C20H26N6O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-[2-(benzylsulfamoyl)ethyl]-4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanamide |
| SMILES | Cn1c(=O)c2c(ncn2CCCC(=O)NCCS(=O)(=O)NCc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C20H26N6O5S/c1-24-18-17(19(28)25(2)20(24)29)26(14-22-18)11-6-9-16(27)21-10-12-32(30,31)23-13-15-7-4-3-5-8-15/h3-5,7-8,14,23H,6,9-13H2,1-2H3,(H,21,27) |
| InChIKey | YHXSSILZOPMPDG-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 137.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |