C19H21N5O4 — CID 122635857
N-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]-4-oxo-4-phenylbutanamide (PubChem CID 122635857) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is N-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]-4-oxo-4-phenylbutanamide.
| Compound Name | N-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 122635857 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]-4-oxo-4-phenylbutanamide |
| SMILES | Cn1c(=O)c2c(ncn2CCNC(=O)CCC(=O)c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C19H21N5O4/c1-22-17-16(18(27)23(2)19(22)28)24(12-21-17)11-10-20-15(26)9-8-14(25)13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3,(H,20,26) |
| InChIKey | GCEUEQIYIXWCER-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |