C14H16N6O3S — CID 8762905
4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 8762905) has the molecular formula C14H16N6O3S and a molecular weight of 348.39 g/mol. Its IUPAC name is 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 8762905 |
| Molecular Formula | C14H16N6O3S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | Cn1c(=O)c2c(ncn2CCCC(=O)Nc2nccs2)n(C)c1=O |
| InChI | InChI=1S/C14H16N6O3S/c1-18-11-10(12(22)19(2)14(18)23)20(8-16-11)6-3-4-9(21)17-13-15-5-7-24-13/h5,7-8H,3-4,6H2,1-2H3,(H,15,17,21) |
| InChIKey | DDRBMHZPDGQTRK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |