C15H13ClN6O5 — CID 26921561
N-(4-chloro-2-nitrophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide (PubChem CID 26921561) has the molecular formula C15H13ClN6O5 and a molecular weight of 392.76 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
|---|---|
| PubChem CID | 26921561 |
| Molecular Formula | C15H13ClN6O5 |
| Molecular Weight | 392.76 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)Nc2ccc(Cl)cc2[N+](=O)[O-])n(C)c1=O |
| InChI | InChI=1S/C15H13ClN6O5/c1-19-13-12(14(24)20(2)15(19)25)21(7-17-13)6-11(23)18-9-4-3-8(16)5-10(9)22(26)27/h3-5,7H,6H2,1-2H3,(H,18,23) |
| InChIKey | APLOAUFXOAABQZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.76 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|