C12H10ClN5O5 — CID 19522139
N-(4-chloro-2-nitrophenyl)-2-(3-methyl-4-nitropyrazol-1-yl)acetamide (PubChem CID 19522139) has the molecular formula C12H10ClN5O5 and a molecular weight of 339.70 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-2-(3-methyl-4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-2-(3-methyl-4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19522139 |
| Molecular Formula | C12H10ClN5O5 |
| Molecular Weight | 339.70 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-2-(3-methyl-4-nitropyrazol-1-yl)acetamide |
| SMILES | Cc1nn(CC(=O)Nc2ccc(Cl)cc2[N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10ClN5O5/c1-7-11(18(22)23)5-16(15-7)6-12(19)14-9-3-2-8(13)4-10(9)17(20)21/h2-5H,6H2,1H3,(H,14,19) |
| InChIKey | VTBBITRRCRTCKM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.70 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|