C19H17ClN4O6S — CID 19522306
N-[3-(4-chlorophenyl)sulfonyl-5-methoxyphenyl]-2-(3-methyl-4-nitropyrazol-1-yl)acetamide (PubChem CID 19522306) has the molecular formula C19H17ClN4O6S and a molecular weight of 464.89 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)sulfonyl-5-methoxyphenyl]-2-(3-methyl-4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[3-(4-chlorophenyl)sulfonyl-5-methoxyphenyl]-2-(3-methyl-4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19522306 |
| Molecular Formula | C19H17ClN4O6S |
| Molecular Weight | 464.89 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | N-[3-(4-chlorophenyl)sulfonyl-5-methoxyphenyl]-2-(3-methyl-4-nitropyrazol-1-yl)acetamide |
| SMILES | COc1cc(NC(=O)Cn2cc([N+](=O)[O-])c(C)n2)cc(S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H17ClN4O6S/c1-12-18(24(26)27)10-23(22-12)11-19(25)21-14-7-15(30-2)9-17(8-14)31(28,29)16-5-3-13(20)4-6-16/h3-10H,11H2,1-2H3,(H,21,25) |
| InChIKey | AJCPMPARWBXXMS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.89 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|