C16H15N7O5 — CID 5453466
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide (PubChem CID 5453466) has the molecular formula C16H15N7O5 and a molecular weight of 385.34 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5453466 |
| Molecular Formula | C16H15N7O5 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)N/N=C\c2ccccc2[N+](=O)[O-])n(C)c1=O |
| InChI | InChI=1S/C16H15N7O5/c1-20-14-13(15(25)21(2)16(20)26)22(9-17-14)8-12(24)19-18-7-10-5-3-4-6-11(10)23(27)28/h3-7,9H,8H2,1-2H3,(H,19,24)/b18-7- |
| InChIKey | QFRMUUNJGWVVKB-WSVATBPTSA-N |
| XLogP | -0.51 |
| TPSA | 146.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|