C20H20N8O4 — CID 136822504
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[(Z)-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]acetamide (PubChem CID 136822504) has the molecular formula C20H20N8O4 and a molecular weight of 436.43 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[(Z)-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[(Z)-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 136822504 |
| Molecular Formula | C20H20N8O4 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N-[(Z)-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]acetamide |
| SMILES | COc1ccc(-c2[nH]ncc2/C=N\NC(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C20H20N8O4/c1-26-18-17(19(30)27(2)20(26)31)28(11-21-18)10-15(29)24-22-8-13-9-23-25-16(13)12-4-6-14(32-3)7-5-12/h4-9,11H,10H2,1-3H3,(H,23,25)(H,24,29)/b22-8- |
| InChIKey | YFPRSAQLACBMJQ-UYOCIXKTSA-N |
| XLogP | -0.02 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|