C21H22N4O3 — CID 3601077
N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]-4-propoxybenzamide (PubChem CID 3601077) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]-4-propoxybenzamide.
| Compound Name | N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]-4-propoxybenzamide |
|---|---|
| PubChem CID | 3601077 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NN=Cc2cn[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H22N4O3/c1-3-12-28-19-10-6-16(7-11-19)21(26)25-23-14-17-13-22-24-20(17)15-4-8-18(27-2)9-5-15/h4-11,13-14H,3,12H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | HIWNSIXCSGXTEL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|