C23H26N4O4 — CID 135647380
N-[(Z)-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]-4-(2-methylpropoxy)benzamide (PubChem CID 135647380) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[(Z)-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]-4-(2-methylpropoxy)benzamide.
| Compound Name | N-[(Z)-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]-4-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 135647380 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-[(Z)-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]-4-(2-methylpropoxy)benzamide |
| SMILES | COc1ccc(-c2[nH]ncc2/C=N\NC(=O)c2ccc(OCC(C)C)cc2)cc1OC |
| InChI | InChI=1S/C23H26N4O4/c1-15(2)14-31-19-8-5-16(6-9-19)23(28)27-25-13-18-12-24-26-22(18)17-7-10-20(29-3)21(11-17)30-4/h5-13,15H,14H2,1-4H3,(H,24,26)(H,27,28)/b25-13- |
| InChIKey | RUEVKZWJJIIFDK-MXAYSNPKSA-N |
| XLogP | 3.89 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|