C22H21N5O3 — CID 135621576
N-[(E)-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]-1-methylindole-3-carboxamide (PubChem CID 135621576) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[(E)-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]-1-methylindole-3-carboxamide.
| Compound Name | N-[(E)-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]-1-methylindole-3-carboxamide |
|---|---|
| PubChem CID | 135621576 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-[(E)-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]-1-methylindole-3-carboxamide |
| SMILES | COc1ccc(-c2[nH]ncc2/C=N/NC(=O)c2cn(C)c3ccccc23)cc1OC |
| InChI | InChI=1S/C22H21N5O3/c1-27-13-17(16-6-4-5-7-18(16)27)22(28)26-24-12-15-11-23-25-21(15)14-8-9-19(29-2)20(10-14)30-3/h4-13H,1-3H3,(H,23,25)(H,26,28)/b24-12+ |
| InChIKey | YVCBNKRTCQLPPR-WYMPLXKRSA-N |
| XLogP | 3.35 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|