C18H17BrN4O4S — CID 171128217
4-bromo-N-[[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide (PubChem CID 171128217) has the molecular formula C18H17BrN4O4S and a molecular weight of 465.33 g/mol. Its IUPAC name is 4-bromo-N-[[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide.
| Compound Name | 4-bromo-N-[[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 171128217 |
| Molecular Formula | C18H17BrN4O4S |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | 4-bromo-N-[[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(-c2[nH]ncc2C=NNS(=O)(=O)c2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C18H17BrN4O4S/c1-26-16-8-3-12(9-17(16)27-2)18-13(10-20-22-18)11-21-23-28(24,25)15-6-4-14(19)5-7-15/h3-11,23H,1-2H3,(H,20,22) |
| InChIKey | ZOFOJHXXOLFDBJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|